C15H20N2O5S — CID 110687848
N-(1,3-benzodioxol-5-ylmethyl)-3-(1,1-dioxothiazinan-2-yl)propanamide (PubChem CID 110687848) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(1,1-dioxothiazinan-2-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1,1-dioxothiazinan-2-yl)propanamide |
|---|---|
| PubChem CID | 110687848 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(1,1-dioxothiazinan-2-yl)propanamide |
| SMILES | O=C(CCN1CCCCS1(=O)=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O5S/c18-15(5-7-17-6-1-2-8-23(17,19)20)16-10-12-3-4-13-14(9-12)22-11-21-13/h3-4,9H,1-2,5-8,10-11H2,(H,16,18) |
| InChIKey | LVJZOGHGDJRJPN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |