C19H23N3O5 — CID 9452818
N-(1,3-benzodioxol-5-ylmethyl)-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide (PubChem CID 9452818) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
|---|---|
| PubChem CID | 9452818 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H23N3O5/c23-16(20-11-13-4-5-14-15(10-13)27-12-26-14)6-9-22-17(24)19(21-18(22)25)7-2-1-3-8-19/h4-5,10H,1-3,6-9,11-12H2,(H,20,23)(H,21,25) |
| InChIKey | UILQAMAJQBXZNV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|