C22H31N5O3 — CID 55749706
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide (PubChem CID 55749706) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 55749706 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)NCc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C22H31N5O3/c28-19(9-14-27-20(29)22(25-21(27)30)10-3-4-11-22)24-16-17-7-8-18(23-15-17)26-12-5-1-2-6-13-26/h7-8,15H,1-6,9-14,16H2,(H,24,28)(H,25,30) |
| InChIKey | FHODYTATDYEHEO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|