C20H27N5O3 — CID 43041648
3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide (PubChem CID 43041648) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 43041648 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-(6-pyrrolidin-1-yl-3-pyridinyl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C20H27N5O3/c26-17(22-15-6-7-16(21-14-15)24-11-4-5-12-24)8-13-25-18(27)20(23-19(25)28)9-2-1-3-10-20/h6-7,14H,1-5,8-13H2,(H,22,26)(H,23,28) |
| InChIKey | AJLJCTQCCPMEHY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|