C21H26N4O4 — CID 24683139
N-[4-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]methyl]phenyl]cyclopropanecarboxamide (PubChem CID 24683139) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[4-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]methyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]methyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 24683139 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[4-[[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoylamino]methyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)NCc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H26N4O4/c26-17(9-12-25-19(28)21(24-20(25)29)10-1-2-11-21)22-13-14-3-7-16(8-4-14)23-18(27)15-5-6-15/h3-4,7-8,15H,1-2,5-6,9-13H2,(H,22,26)(H,23,27)(H,24,29) |
| InChIKey | YQIRQVLPIYZSCJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|