C20H25N3O5 — CID 7043089
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7043089) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7043089 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4R)-4-cyclohexyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(C2CCCCC2)NC(=O)N(CC(=O)NCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C20H25N3O5/c1-20(14-5-3-2-4-6-14)18(25)23(19(26)22-20)11-17(24)21-10-13-7-8-15-16(9-13)28-12-27-15/h7-9,14H,2-6,10-12H2,1H3,(H,21,24)(H,22,26)/t20-/m1/s1 |
| InChIKey | SCSDZRVKLKXTFS-HXUWFJFHSA-N |
| XLogP | 1.92 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|