C21H27N3O5 — CID 40931197
2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclooctylacetamide (PubChem CID 40931197) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclooctylacetamide.
| Compound Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclooctylacetamide |
|---|---|
| PubChem CID | 40931197 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclooctylacetamide |
| SMILES | C[C@@]1(c2ccc3c(c2)OCO3)NC(=O)N(CC(=O)NC2CCCCCCC2)C1=O |
| InChI | InChI=1S/C21H27N3O5/c1-21(14-9-10-16-17(11-14)29-13-28-16)19(26)24(20(27)23-21)12-18(25)22-15-7-5-3-2-4-6-8-15/h9-11,15H,2-8,12-13H2,1H3,(H,22,25)(H,23,27)/t21-/m0/s1 |
| InChIKey | LMJWHDJWUCJGOC-NRFANRHFSA-N |
| XLogP | 2.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|