C21H27N3O5 — CID 7692105
2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexyl-N-ethylacetamide (PubChem CID 7692105) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexyl-N-ethylacetamide.
| Compound Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexyl-N-ethylacetamide |
|---|---|
| PubChem CID | 7692105 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)CN1C(=O)N[C@@](C)(c2ccc3c(c2)OCO3)C1=O)C1CCCCC1 |
| InChI | InChI=1S/C21H27N3O5/c1-3-23(15-7-5-4-6-8-15)18(25)12-24-19(26)21(2,22-20(24)27)14-9-10-16-17(11-14)29-13-28-16/h9-11,15H,3-8,12-13H2,1-2H3,(H,22,27)/t21-/m0/s1 |
| InChIKey | RDOZUTPPZKMZPY-NRFANRHFSA-N |
| XLogP | 2.36 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|