C26H29N3O5 — CID 41156839
N-cyclohexyl-2-[(4R)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 41156839) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4R)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[(4R)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 41156839 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-cyclohexyl-2-[(4R)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | C[C@]1(c2ccc3c(c2)OCCO3)NC(=O)N(CC(=O)N(c2ccccc2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C26H29N3O5/c1-26(18-12-13-21-22(16-18)34-15-14-33-21)24(31)28(25(32)27-26)17-23(30)29(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2,4-5,8-9,12-13,16,20H,3,6-7,10-11,14-15,17H2,1H3,(H,27,32)/t26-/m1/s1 |
| InChIKey | ZJGIUJIYJDDVFX-AREMUKBSSA-N |
| XLogP | 3.59 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|