C24H27N3O3 — CID 6993214
N-cyclohexyl-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 6993214) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 6993214 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-cyclohexyl-2-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)N(c2ccccc2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C24H27N3O3/c1-24(18-11-5-2-6-12-18)22(29)26(23(30)25-24)17-21(28)27(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-3,5-8,11-14,20H,4,9-10,15-17H2,1H3,(H,25,30)/t24-/m0/s1 |
| InChIKey | GOARJXVPQOMPAP-DEOSSOPVSA-N |
| XLogP | 3.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|