C26H29N3O3 — CID 41179879
N-cyclohexyl-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-phenylacetamide (PubChem CID 41179879) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 41179879 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-cyclohexyl-2-[(4R)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]-N-phenylacetamide |
| SMILES | O=C1N[C@@]2(CCCc3ccccc32)C(=O)N1CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H29N3O3/c30-23(29(20-12-3-1-4-13-20)21-14-5-2-6-15-21)18-28-24(31)26(27-25(28)32)17-9-11-19-10-7-8-16-22(19)26/h1,3-4,7-8,10,12-13,16,21H,2,5-6,9,11,14-15,17-18H2,(H,27,32)/t26-/m1/s1 |
| InChIKey | JVIVOIPRBTWWHH-AREMUKBSSA-N |
| XLogP | 4.14 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|