C28H41N3O3 — CID 26716014
2-[(4R)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide (PubChem CID 26716014) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is 2-[(4R)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide.
| Compound Name | 2-[(4R)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
|---|---|
| PubChem CID | 26716014 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | 2-[(4R)-4-(4-tert-butylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
| SMILES | CC(C)(C)c1ccc([C@@]2(C)NC(=O)N(CC(=O)N(C3CCCCC3)C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C28H41N3O3/c1-27(2,3)20-15-17-21(18-16-20)28(4)25(33)30(26(34)29-28)19-24(32)31(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h15-18,22-23H,5-14,19H2,1-4H3,(H,29,34)/t28-/m1/s1 |
| InChIKey | CAVUNVZWNNSHKW-MUUNZHRXSA-N |
| XLogP | 5.25 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|