C24H32BrN3O3 — CID 41100880
2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide (PubChem CID 41100880) has the molecular formula C24H32BrN3O3 and a molecular weight of 490.44 g/mol. Its IUPAC name is 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide.
| Compound Name | 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
|---|---|
| PubChem CID | 41100880 |
| Molecular Formula | C24H32BrN3O3 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
| SMILES | C[C@]1(c2cccc(Br)c2)NC(=O)N(CC(=O)N(C2CCCCC2)C2CCCCC2)C1=O |
| InChI | InChI=1S/C24H32BrN3O3/c1-24(17-9-8-10-18(25)15-17)22(30)27(23(31)26-24)16-21(29)28(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h8-10,15,19-20H,2-7,11-14,16H2,1H3,(H,26,31)/t24-/m1/s1 |
| InChIKey | PVAOABXLTRJMIE-XMMPIXPASA-N |
| XLogP | 4.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|