C18H22BrN3O3 — CID 7178060
(5S)-5-(3-bromophenyl)-5-methyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 7178060) has the molecular formula C18H22BrN3O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is (5S)-5-(3-bromophenyl)-5-methyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3-bromophenyl)-5-methyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7178060 |
| Molecular Formula | C18H22BrN3O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (5S)-5-(3-bromophenyl)-5-methyl-3-[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CCCN(C(=O)CN2C(=O)N[C@@](C)(c3cccc(Br)c3)C2=O)C1 |
| InChI | InChI=1S/C18H22BrN3O3/c1-12-5-4-8-21(10-12)15(23)11-22-16(24)18(2,20-17(22)25)13-6-3-7-14(19)9-13/h3,6-7,9,12H,4-5,8,10-11H2,1-2H3,(H,20,25)/t12-,18+/m1/s1 |
| InChIKey | NZXDPKZGJWVRAM-XIKOKIGWSA-N |
| XLogP | 2.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|