C19H23BrN4O5 — CID 43063936
ethyl 4-[2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate (PubChem CID 43063936) has the molecular formula C19H23BrN4O5 and a molecular weight of 467.32 g/mol. Its IUPAC name is ethyl 4-[2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 43063936 |
| Molecular Formula | C19H23BrN4O5 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | ethyl 4-[2-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN2C(=O)NC(C)(c3cccc(Br)c3)C2=O)CC1 |
| InChI | InChI=1S/C19H23BrN4O5/c1-3-29-18(28)23-9-7-22(8-10-23)15(25)12-24-16(26)19(2,21-17(24)27)13-5-4-6-14(20)11-13/h4-6,11H,3,7-10,12H2,1-2H3,(H,21,27) |
| InChIKey | KNYGMOFEENHOFG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|