C20H26BrN3O3 — CID 93011595
2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 93011595) has the molecular formula C20H26BrN3O3 and a molecular weight of 436.35 g/mol. Its IUPAC name is 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 93011595 |
| Molecular Formula | C20H26BrN3O3 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CN1C(=O)N[C@](C)(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C20H26BrN3O3/c1-12-6-4-9-16(13(12)2)22-17(25)11-24-18(26)20(3,23-19(24)27)14-7-5-8-15(21)10-14/h5,7-8,10,12-13,16H,4,6,9,11H2,1-3H3,(H,22,25)(H,23,27)/t12-,13-,16+,20-/m1/s1 |
| InChIKey | BOBQLVBUZPIZQF-AWUHREGDSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|