C17H21N3O5 — CID 7691962
2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide (PubChem CID 7691962) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide.
| Compound Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 7691962 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[(4R)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN1C(=O)N[C@](C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C17H21N3O5/c1-3-4-7-18-14(21)9-20-15(22)17(2,19-16(20)23)11-5-6-12-13(8-11)25-10-24-12/h5-6,8H,3-4,7,9-10H2,1-2H3,(H,18,21)(H,19,23)/t17-/m1/s1 |
| InChIKey | LPJAVXLCPGHTJU-QGZVFWFLSA-N |
| XLogP | 1.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|