C14H16N2O4 — CID 17396815
5-(1,3-benzodioxol-5-yl)-5-methyl-3-propylimidazolidine-2,4-dione (PubChem CID 17396815) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-methyl-3-propylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17396815 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C14H16N2O4/c1-3-6-16-12(17)14(2,15-13(16)18)9-4-5-10-11(7-9)20-8-19-10/h4-5,7H,3,6,8H2,1-2H3,(H,15,18) |
| InChIKey | SVVVUJQBIXVNFS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|