C16H15N3O5 — CID 126829801
5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-methyl-1,3-oxazol-5-yl)methyl]imidazolidine-2,4-dione (PubChem CID 126829801) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-methyl-1,3-oxazol-5-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-methyl-1,3-oxazol-5-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126829801 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[(4-methyl-1,3-oxazol-5-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ncoc1CN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C16H15N3O5/c1-9-13(22-7-17-9)6-19-14(20)16(2,18-15(19)21)10-3-4-11-12(5-10)24-8-23-11/h3-5,7H,6,8H2,1-2H3,(H,18,21) |
| InChIKey | KVSABKAGJHNIDC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|