C15H16N2O6 — CID 7692011
ethyl 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7692011) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is ethyl 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | ethyl 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7692011 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | ethyl 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)N[C@@](C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C15H16N2O6/c1-3-21-12(18)7-17-13(19)15(2,16-14(17)20)9-4-5-10-11(6-9)23-8-22-10/h4-6H,3,7-8H2,1-2H3,(H,16,20)/t15-/m0/s1 |
| InChIKey | KKNNHKLPPCQEAV-HNNXBMFYSA-N |
| XLogP | 0.75 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|