C18H22N2O6 — CID 7483962
butyl 2-[(4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7483962) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is butyl 2-[(4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | butyl 2-[(4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7483962 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | butyl 2-[(4S)-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)N[C@@](C)(c2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C18H22N2O6/c1-3-4-7-26-15(21)11-20-16(22)18(2,19-17(20)23)12-5-6-13-14(10-12)25-9-8-24-13/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | GVMTUYNOQVSEAF-SFHVURJKSA-N |
| XLogP | 1.57 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|