C22H24N2O6 — CID 7483865
(5S)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(4-ethoxyphenoxy)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7483865) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (5S)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(4-ethoxyphenoxy)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(4-ethoxyphenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7483865 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (5S)-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-(4-ethoxyphenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCOc1ccc(OCCN2C(=O)N[C@@](C)(c3ccc4c(c3)OCCO4)C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-27-16-5-7-17(8-6-16)28-11-10-24-20(25)22(2,23-21(24)26)15-4-9-18-19(14-15)30-13-12-29-18/h4-9,14H,3,10-13H2,1-2H3,(H,23,26)/t22-/m0/s1 |
| InChIKey | DDAAXMUDHYLHMG-QFIPXVFZSA-N |
| XLogP | 2.70 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|