C20H18N2O5 — CID 17452081
5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-(4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 17452081) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-(4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-(4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17452081 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-(4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)CN2C(=O)NC(C)(c3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-12-3-5-13(6-4-12)15(23)10-22-18(24)20(2,21-19(22)25)14-7-8-16-17(9-14)27-11-26-16/h3-9H,10-11H2,1-2H3,(H,21,25) |
| InChIKey | CJLNJYSJCDGDFE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|