C23H23N3O7S — CID 2525067
(5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 2525067) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2525067 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (5S)-5-(1,3-benzodioxol-5-yl)-5-methyl-3-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccc3c(c2)OCO3)NC(=O)N(CC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C23H23N3O7S/c1-23(16-6-9-19-20(12-16)33-14-32-19)21(28)26(22(29)24-23)13-18(27)15-4-7-17(8-5-15)34(30,31)25-10-2-3-11-25/h4-9,12H,2-3,10-11,13-14H2,1H3,(H,24,29)/t23-/m0/s1 |
| InChIKey | HSFVSRQYHWJGLC-QHCPKHFHSA-N |
| XLogP | 1.85 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|