C18H26N2O5S — CID 110299793
N-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide (PubChem CID 110299793) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 110299793 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide |
| SMILES | O=C(CCCCS(=O)(=O)N1CCCCC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H26N2O5S/c21-18(19-13-15-7-8-16-17(12-15)25-14-24-16)6-2-5-11-26(22,23)20-9-3-1-4-10-20/h7-8,12H,1-6,9-11,13-14H2,(H,19,21) |
| InChIKey | KKGWROVCGLWOSH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|