C22H26N2O5S — CID 26911264
N-(1,3-benzodioxol-5-ylmethyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 26911264) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 26911264 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H26N2O5S/c25-22(23-15-18-6-10-20-21(14-18)29-16-28-20)11-7-17-4-8-19(9-5-17)30(26,27)24-12-2-1-3-13-24/h4-6,8-10,14H,1-3,7,11-13,15-16H2,(H,23,25) |
| InChIKey | DQDXLWQPWRWXDZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |