C20H21FN2O5S — CID 3236436
N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 3236436) has the molecular formula C20H21FN2O5S and a molecular weight of 420.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3236436 |
| Molecular Formula | C20H21FN2O5S |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cc(S(=O)(=O)N2CCCCC2)ccc1F |
| InChI | InChI=1S/C20H21FN2O5S/c21-17-6-5-15(29(25,26)23-8-2-1-3-9-23)11-16(17)20(24)22-12-14-4-7-18-19(10-14)28-13-27-18/h4-7,10-11H,1-3,8-9,12-13H2,(H,22,24) |
| InChIKey | CKVXWZVISYKBMU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |