C21H27IN4O4S — CID 111845420
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111845420) has the molecular formula C21H27IN4O4S and a molecular weight of 558.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845420 |
| Molecular Formula | C21H27IN4O4S |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C21H26N4O4S.HI/c1-22-21(24-14-17-6-9-19-20(12-17)29-15-28-19)23-13-16-4-7-18(8-5-16)30(26,27)25-10-2-3-11-25;/h4-9,12H,2-3,10-11,13-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | XWPFGZLHECDRKN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|