C19H26N4O2S2 — CID 111897585
2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111897585) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111897585 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NCc1ccc(C)s1 |
| InChI | InChI=1S/C19H26N4O2S2/c1-15-5-8-17(26-15)14-22-19(20-2)21-13-16-6-9-18(10-7-16)27(24,25)23-11-3-4-12-23/h5-10H,3-4,11-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | LYSYSWPSEGQLKG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|