C18H25IN4O2S2 — CID 111939018
2-methyl-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939018) has the molecular formula C18H25IN4O2S2 and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-methyl-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939018 |
| Molecular Formula | C18H25IN4O2S2 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 2-methyl-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NCc1ccsc1.I |
| InChI | InChI=1S/C18H24N4O2S2.HI/c1-19-18(21-13-16-8-11-25-14-16)20-12-15-4-6-17(7-5-15)26(23,24)22-9-2-3-10-22;/h4-8,11,14H,2-3,9-10,12-13H2,1H3,(H2,19,20,21);1H |
| InChIKey | STUAFHMSAGJJKC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|