C20H29IN4O2S2 — CID 111351379
2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111351379) has the molecular formula C20H29IN4O2S2 and a molecular weight of 548.52 g/mol. Its IUPAC name is 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111351379 |
| Molecular Formula | C20H29IN4O2S2 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1.I |
| InChI | InChI=1S/C20H28N4O2S2.HI/c1-21-20(22-12-11-18-6-5-15-27-18)23-16-17-7-9-19(10-8-17)28(25,26)24-13-3-2-4-14-24;/h5-10,15H,2-4,11-14,16H2,1H3,(H2,21,22,23);1H |
| InChIKey | IBWYOERHIYTPIO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|