C17H23IN4O2S2 — CID 111940134
1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111940134) has the molecular formula C17H23IN4O2S2 and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111940134 |
| Molecular Formula | C17H23IN4O2S2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 1-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NC2CC2)cc1)NCc1ccsc1.I |
| InChI | InChI=1S/C17H22N4O2S2.HI/c1-18-17(20-11-14-8-9-24-12-14)19-10-13-2-6-16(7-3-13)25(22,23)21-15-4-5-15;/h2-3,6-9,12,15,21H,4-5,10-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | XFARATZLTQQMTP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|