C14H17IN4O2S — CID 111939736
2-methyl-1-[(4-nitrophenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939736) has the molecular formula C14H17IN4O2S and a molecular weight of 432.29 g/mol. Its IUPAC name is 2-methyl-1-[(4-nitrophenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939736 |
| Molecular Formula | C14H17IN4O2S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc([N+](=O)[O-])cc1)NCc1ccsc1.I |
| InChI | InChI=1S/C14H16N4O2S.HI/c1-15-14(17-9-12-6-7-21-10-12)16-8-11-2-4-13(5-3-11)18(19)20;/h2-7,10H,8-9H2,1H3,(H2,15,16,17);1H |
| InChIKey | HVSOFETZOREGQC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|