C21H27F2IN4O2S — CID 111902388
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111902388) has the molecular formula C21H27F2IN4O2S and a molecular weight of 564.44 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111902388 |
| Molecular Formula | C21H27F2IN4O2S |
| Molecular Weight | 564.44 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCCC2)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C21H26F2N4O2S.HI/c1-24-21(26-15-17-13-18(22)7-10-20(17)23)25-14-16-5-8-19(9-6-16)30(28,29)27-11-3-2-4-12-27;/h5-10,13H,2-4,11-12,14-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | FOJYYBGXACAIPM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|