C23H28N2O5S — CID 126236174
N-(1,3-benzodioxol-5-ylmethyl)-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide (PubChem CID 126236174) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 126236174 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)NC2CCCCC2)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H28N2O5S/c26-23(24-15-18-8-12-21-22(14-18)30-16-29-21)13-9-17-6-10-20(11-7-17)31(27,28)25-19-4-2-1-3-5-19/h6-8,10-12,14,19,25H,1-5,9,13,15-16H2,(H,24,26) |
| InChIKey | WHWVRAGKIZLJAQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |