C20H25N3O3S — CID 110355634
3-[4-(cyclopentylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 110355634) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-[4-(cyclopentylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[4-(cyclopentylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 110355634 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-[4-(cyclopentylsulfamoyl)phenyl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)NC2CCCC2)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C20H25N3O3S/c24-20(22-15-17-4-3-13-21-14-17)12-9-16-7-10-19(11-8-16)27(25,26)23-18-5-1-2-6-18/h3-4,7-8,10-11,13-14,18,23H,1-2,5-6,9,12,15H2,(H,22,24) |
| InChIKey | HSFPGGNMZGIGLO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |