C18H23N3O4S2 — CID 3769450
4-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)benzene-1,4-disulfonamide (PubChem CID 3769450) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 3769450 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-N-cyclohexyl-1-N-(pyridin-3-ylmethyl)benzene-1,4-disulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1)c1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H23N3O4S2/c22-26(23,20-14-15-5-4-12-19-13-15)17-8-10-18(11-9-17)27(24,25)21-16-6-2-1-3-7-16/h4-5,8-13,16,20-21H,1-3,6-7,14H2 |
| InChIKey | ZAUPHGAHDOPGLW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |