C20H26N2O4S2 — CID 1429121
4-N-cyclohexyl-1-N-(2-phenylethyl)benzene-1,4-disulfonamide (PubChem CID 1429121) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-N-cyclohexyl-1-N-(2-phenylethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-cyclohexyl-1-N-(2-phenylethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 1429121 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-N-cyclohexyl-1-N-(2-phenylethyl)benzene-1,4-disulfonamide |
| SMILES | O=S(=O)(NCCc1ccccc1)c1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N2O4S2/c23-27(24,21-16-15-17-7-3-1-4-8-17)19-11-13-20(14-12-19)28(25,26)22-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18,21-22H,2,5-6,9-10,15-16H2 |
| InChIKey | ZVNDATNPABFFSJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |