C21H27N3O5S2 — CID 17225977
3-(benzenesulfonamido)-N-[4-(cyclohexylsulfamoyl)phenyl]propanamide (PubChem CID 17225977) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[4-(cyclohexylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17225977 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[4-(cyclohexylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H27N3O5S2/c25-21(15-16-22-30(26,27)19-9-5-2-6-10-19)23-17-11-13-20(14-12-17)31(28,29)24-18-7-3-1-4-8-18/h2,5-6,9-14,18,22,24H,1,3-4,7-8,15-16H2,(H,23,25) |
| InChIKey | WEMDVPVQZWGPIY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |