C26H28N2O4S — CID 4511876
N-[4-(cyclohexylsulfamoyl)phenyl]-2-(4-phenylphenoxy)acetamide (PubChem CID 4511876) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 4511876 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H28N2O4S/c29-26(19-32-24-15-11-21(12-16-24)20-7-3-1-4-8-20)27-22-13-17-25(18-14-22)33(30,31)28-23-9-5-2-6-10-23/h1,3-4,7-8,11-18,23,28H,2,5-6,9-10,19H2,(H,27,29) |
| InChIKey | GIMSXLJHHBHZIY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |