C23H28N2O6S — CID 2943450
ethyl 4-[[2-[4-(cyclohexylsulfamoyl)phenoxy]acetyl]amino]benzoate (PubChem CID 2943450) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(cyclohexylsulfamoyl)phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-(cyclohexylsulfamoyl)phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2943450 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | ethyl 4-[[2-[4-(cyclohexylsulfamoyl)phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O6S/c1-2-30-23(27)17-8-10-18(11-9-17)24-22(26)16-31-20-12-14-21(15-13-20)32(28,29)25-19-6-4-3-5-7-19/h8-15,19,25H,2-7,16H2,1H3,(H,24,26) |
| InChIKey | MUZGCMVEENMLMT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |