C22H28N2O5S — CID 17353443
N-[4-(cyclohexylsulfamoyl)phenyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17353443) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17353443 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O5S/c1-28-15-16-29-20-11-7-17(8-12-20)22(25)23-18-9-13-21(14-10-18)30(26,27)24-19-5-3-2-4-6-19/h7-14,19,24H,2-6,15-16H2,1H3,(H,23,25) |
| InChIKey | DVZXAMQADFHTPX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|