C25H33N3O4S2 — CID 4948886
N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 4948886) has the molecular formula C25H33N3O4S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4948886 |
| Molecular Formula | C25H33N3O4S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O4S2/c1-18(2)16-17-32-22-12-8-19(9-13-22)24(29)27-25(33)26-20-10-14-23(15-11-20)34(30,31)28-21-6-4-3-5-7-21/h8-15,18,21,28H,3-7,16-17H2,1-2H3,(H2,26,27,29,33) |
| InChIKey | PTYRLFXVKNOSOM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|