C26H36N2O3S — CID 4951029
4-heptoxy-N-[[4-(3-methylbutoxy)phenyl]carbamothioyl]benzamide (PubChem CID 4951029) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is 4-heptoxy-N-[[4-(3-methylbutoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-heptoxy-N-[[4-(3-methylbutoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4951029 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 4-heptoxy-N-[[4-(3-methylbutoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(OCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O3S/c1-4-5-6-7-8-18-30-23-13-9-21(10-14-23)25(29)28-26(32)27-22-11-15-24(16-12-22)31-19-17-20(2)3/h9-16,20H,4-8,17-19H2,1-3H3,(H2,27,28,29,32) |
| InChIKey | NXYAQFQLJCEVOK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|