C20H23FN2O3S — CID 109061223
4-(cycloheptylsulfamoyl)-N-(4-fluorophenyl)benzamide (PubChem CID 109061223) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(cycloheptylsulfamoyl)-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-(cycloheptylsulfamoyl)-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 109061223 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-(cycloheptylsulfamoyl)-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(S(=O)(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H23FN2O3S/c21-16-9-11-17(12-10-16)22-20(24)15-7-13-19(14-8-15)27(25,26)23-18-5-3-1-2-4-6-18/h7-14,18,23H,1-6H2,(H,22,24) |
| InChIKey | HYAHBVASTOCPET-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |