C17H15F3N2O3S — CID 26701623
4-(cyclopropylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 26701623) has the molecular formula C17H15F3N2O3S and a molecular weight of 384.38 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26701623 |
| Molecular Formula | C17H15F3N2O3S |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H15F3N2O3S/c18-17(19,20)12-3-5-13(6-4-12)21-16(23)11-1-9-15(10-2-11)26(24,25)22-14-7-8-14/h1-6,9-10,14,22H,7-8H2,(H,21,23) |
| InChIKey | UQBPYHAOSYOZIP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |