C20H20F3N3O4S — CID 34508335
N-[2-[[4-(cyclopropylsulfamoyl)benzoyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 34508335) has the molecular formula C20H20F3N3O4S and a molecular weight of 455.46 g/mol. Its IUPAC name is N-[2-[[4-(cyclopropylsulfamoyl)benzoyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[4-(cyclopropylsulfamoyl)benzoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 34508335 |
| Molecular Formula | C20H20F3N3O4S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[2-[[4-(cyclopropylsulfamoyl)benzoyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3N3O4S/c21-20(22,23)15-5-1-13(2-6-15)18(27)24-11-12-25-19(28)14-3-9-17(10-4-14)31(29,30)26-16-7-8-16/h1-6,9-10,16,26H,7-8,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | QLPVICKEKZSCEN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|