C18H20N2O3S2 — CID 27887946
4-(cyclopropylsulfamoyl)-N-(2-phenylsulfanylethyl)benzamide (PubChem CID 27887946) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-(2-phenylsulfanylethyl)benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-(2-phenylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 27887946 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-(2-phenylsulfanylethyl)benzamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H20N2O3S2/c21-18(19-12-13-24-16-4-2-1-3-5-16)14-6-10-17(11-7-14)25(22,23)20-15-8-9-15/h1-7,10-11,15,20H,8-9,12-13H2,(H,19,21) |
| InChIKey | ZPNOPUPHIAWJNJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|