C17H25N3O4S — CID 47067351
N-[3-(butan-2-ylamino)-3-oxopropyl]-4-(cyclopropylsulfamoyl)benzamide (PubChem CID 47067351) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-4-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 47067351 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-(cyclopropylsulfamoyl)benzamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-3-12(2)19-16(21)10-11-18-17(22)13-4-8-15(9-5-13)25(23,24)20-14-6-7-14/h4-5,8-9,12,14,20H,3,6-7,10-11H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | UANMGHJYEDYWFJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |