C17H23N3O4S — CID 52510027
N-[3-[[(2R)-butan-2-yl]amino]-3-oxopropyl]-4-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 52510027) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[3-[[(2R)-butan-2-yl]amino]-3-oxopropyl]-4-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-[3-[[(2R)-butan-2-yl]amino]-3-oxopropyl]-4-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 52510027 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[3-[[(2R)-butan-2-yl]amino]-3-oxopropyl]-4-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)NCCC(=O)N[C@H](C)CC)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-4-11-19-25(23,24)15-8-6-14(7-9-15)17(22)18-12-10-16(21)20-13(3)5-2/h1,6-9,13,19H,5,10-12H2,2-3H3,(H,18,22)(H,20,21)/t13-/m1/s1 |
| InChIKey | DQICAXBSFKBSQJ-CYBMUJFWSA-N |
| XLogP | 0.63 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|